C27H23N3O4 — CID 5170687
naphthalen-2-yl 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate (PubChem CID 5170687) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is naphthalen-2-yl 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate.
| Compound Name | naphthalen-2-yl 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 5170687 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | naphthalen-2-yl 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
| SMILES | CC12CCC(C(=O)Oc3ccc4ccccc4c3)(c3nc4cc([N+](=O)[O-])ccc4nc31)C2(C)C |
| InChI | InChI=1S/C27H23N3O4/c1-25(2)26(3)12-13-27(25,24(31)34-19-10-8-16-6-4-5-7-17(16)14-19)23-22(26)28-20-11-9-18(30(32)33)15-21(20)29-23/h4-11,14-15H,12-13H2,1-3H3 |
| InChIKey | DZBBKZOZFZIPIN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|