C24H20N4O3S2 — CID 5183160
S-(1,3-benzothiazol-2-yl) 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbothioate (PubChem CID 5183160) has the molecular formula C24H20N4O3S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbothioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbothioate |
|---|---|
| PubChem CID | 5183160 |
| Molecular Formula | C24H20N4O3S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbothioate |
| SMILES | CC12CCC(C(=O)Sc3nc4ccccc4s3)(c3nc4cc([N+](=O)[O-])ccc4nc31)C2(C)C |
| InChI | InChI=1S/C24H20N4O3S2/c1-22(2)23(3)10-11-24(22,20(29)33-21-27-15-6-4-5-7-17(15)32-21)19-18(23)25-14-9-8-13(28(30)31)12-16(14)26-19/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | BDHCYUHHNMNZKP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|