C22H22N2O2 — CID 98469684
methyl (1S,16R)-16,19,19-trimethyl-3,14-diazapentacyclo[14.2.1.02,15.04,13.06,11]nonadeca-2,4,6,8,10,12,14-heptaene-1-carboxylate (PubChem CID 98469684) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl (1S,16R)-16,19,19-trimethyl-3,14-diazapentacyclo[14.2.1.02,15.04,13.06,11]nonadeca-2,4,6,8,10,12,14-heptaene-1-carboxylate.
| Compound Name | methyl (1S,16R)-16,19,19-trimethyl-3,14-diazapentacyclo[14.2.1.02,15.04,13.06,11]nonadeca-2,4,6,8,10,12,14-heptaene-1-carboxylate |
|---|---|
| PubChem CID | 98469684 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | methyl (1S,16R)-16,19,19-trimethyl-3,14-diazapentacyclo[14.2.1.02,15.04,13.06,11]nonadeca-2,4,6,8,10,12,14-heptaene-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@](C)(c3nc4cc5ccccc5cc4nc31)C2(C)C |
| InChI | InChI=1S/C22H22N2O2/c1-20(2)21(3)9-10-22(20,19(25)26-4)18-17(21)23-15-11-13-7-5-6-8-14(13)12-16(15)24-18/h5-8,11-12H,9-10H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | WUPKUQYIWMPOFJ-VXKWHMMOSA-N |
| XLogP | 4.29 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|