C27H28N2O4 — CID 5261329
(4-propan-2-ylphenyl) 15,18,18-trimethyl-7,9-dioxa-3,13-diazapentacyclo[13.2.1.02,14.04,12.06,10]octadeca-2,4,6(10),11,13-pentaene-1-carboxylate (PubChem CID 5261329) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 15,18,18-trimethyl-7,9-dioxa-3,13-diazapentacyclo[13.2.1.02,14.04,12.06,10]octadeca-2,4,6(10),11,13-pentaene-1-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 15,18,18-trimethyl-7,9-dioxa-3,13-diazapentacyclo[13.2.1.02,14.04,12.06,10]octadeca-2,4,6(10),11,13-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 5261329 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (4-propan-2-ylphenyl) 15,18,18-trimethyl-7,9-dioxa-3,13-diazapentacyclo[13.2.1.02,14.04,12.06,10]octadeca-2,4,6(10),11,13-pentaene-1-carboxylate |
| SMILES | CC(C)c1ccc(OC(=O)C23CCC(C)(c4nc5cc6c(cc5nc42)OCO6)C3(C)C)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-15(2)16-6-8-17(9-7-16)33-24(30)27-11-10-26(5,25(27,3)4)22-23(27)29-19-13-21-20(31-14-32-21)12-18(19)28-22/h6-9,12-13,15H,10-11,14H2,1-5H3 |
| InChIKey | PZZZLYQQLUENCO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|