C24H24N4O2 — CID 18827369
(4-propan-2-ylphenyl) 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate (PubChem CID 18827369) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 18827369 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (4-propan-2-ylphenyl) 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
| SMILES | CC(C)c1ccc(OC(=O)C23CCC(C)(c4nc(C#N)c(C#N)nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-14(2)15-6-8-16(9-7-15)30-21(29)24-11-10-23(5,22(24,3)4)19-20(24)28-18(13-26)17(12-25)27-19/h6-9,14H,10-11H2,1-5H3 |
| InChIKey | XWLSKPHPBGWLFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|