C24H21NO4 — CID 6576869
[4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 6576869) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 6576869 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)CC[C@@]1(C)C(=O)C2=O |
| InChI | InChI=1S/C24H21NO4/c1-22(2)23(3)12-13-24(22,20(27)19(23)26)21(28)29-18-10-8-17(9-11-18)16-6-4-15(14-25)5-7-16/h4-11H,12-13H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | LYYBYAIJZIINMI-ZEQRLZLVSA-N |
| XLogP | 4.10 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|