C17H20O4 — CID 4861582
(4-methylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 4861582) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (4-methylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (4-methylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 4861582 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (4-methylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C23CCC(C)(C(=O)O2)C3(C)C)cc1 |
| InChI | InChI=1S/C17H20O4/c1-11-5-7-12(8-6-11)20-14(19)17-10-9-16(4,13(18)21-17)15(17,2)3/h5-8H,9-10H2,1-4H3 |
| InChIKey | IDSBWIAPKJGQOW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|