C17H16Cl2O4 — CID 4861680
(2,4-dichlorophenyl) 4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 4861680) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (2,4-dichlorophenyl) 4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 4861680 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2,4-dichlorophenyl) 4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)Oc3ccc(Cl)cc3Cl)(C(=O)C1=O)C2(C)C |
| InChI | InChI=1S/C17H16Cl2O4/c1-15(2)16(3)6-7-17(15,13(21)12(16)20)14(22)23-11-5-4-9(18)8-10(11)19/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | NAUWNPXGQJRJCN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|