C23H21NO4 — CID 1178642
[4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 1178642) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 1178642 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)Oc1ccc(-c3ccc(C#N)cc3)cc1)OC2=O |
| InChI | InChI=1S/C23H21NO4/c1-21(2)22(3)12-13-23(21,28-19(22)25)20(26)27-18-10-8-17(9-11-18)16-6-4-15(14-24)5-7-16/h4-11H,12-13H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | XMNOZHGPEKGZRT-XZOQPEGZSA-N |
| XLogP | 4.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|