C24H23NO3 — CID 50937917
[4-(4-cyanophenyl)phenyl] (1R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 50937917) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (1R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (1R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 50937917 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (1R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)CC[C@@]1(C)C(=O)C2 |
| InChI | InChI=1S/C24H23NO3/c1-22(2)23(3)12-13-24(22,14-20(23)26)21(27)28-19-10-8-18(9-11-19)17-6-4-16(15-25)5-7-17/h4-11H,12-14H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | ILHUGSXRANMEIC-ZEQRLZLVSA-N |
| XLogP | 4.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|