C16H16N4O2 — CID 18827357
methyl 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate (PubChem CID 18827357) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate.
| Compound Name | methyl 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 18827357 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
| SMILES | COC(=O)C12CCC(C)(c3nc(C#N)c(C#N)nc31)C2(C)C |
| InChI | InChI=1S/C16H16N4O2/c1-14(2)15(3)5-6-16(14,13(21)22-4)12-11(15)19-9(7-17)10(8-18)20-12/h5-6H2,1-4H3 |
| InChIKey | HBNHIPYHJAGRQI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |