C24H22F3N3O — CID 6576834
(1S,12R)-12,15,15-trimethyl-N-[2-(trifluoromethyl)phenyl]-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 6576834) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is (1S,12R)-12,15,15-trimethyl-N-[2-(trifluoromethyl)phenyl]-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | (1S,12R)-12,15,15-trimethyl-N-[2-(trifluoromethyl)phenyl]-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 6576834 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (1S,12R)-12,15,15-trimethyl-N-[2-(trifluoromethyl)phenyl]-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(C(=O)Nc1ccccc1C(F)(F)F)c1nc3ccccc3nc12 |
| InChI | InChI=1S/C24H22F3N3O/c1-21(2)22(3)12-13-23(21,19-18(22)28-16-10-6-7-11-17(16)29-19)20(31)30-15-9-5-4-8-14(15)24(25,26)27/h4-11H,12-13H2,1-3H3,(H,30,31)/t22-,23-/m0/s1 |
| InChIKey | KOVQRPKIMYZUMM-GOTSBHOMSA-N |
| XLogP | 5.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |