C22H20ClN5O — CID 18827215
N-[(2-chlorophenyl)methyl]-4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18827215) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18827215 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC12CCC(C(=O)NCc3ccccc3Cl)(c3nc(C#N)c(C#N)nc31)C2(C)C |
| InChI | InChI=1S/C22H20ClN5O/c1-20(2)21(3)8-9-22(20,18-17(21)27-15(10-24)16(11-25)28-18)19(29)26-12-13-6-4-5-7-14(13)23/h4-7H,8-9,12H2,1-3H3,(H,26,29) |
| InChIKey | PRRLZQTUZZRAOW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |