C21H16N6O5 — CID 18834949
4,5-dicyano-11,11-dimethyl-N-(6-nitro-1,3-benzodioxol-5-yl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18834949) has the molecular formula C21H16N6O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is 4,5-dicyano-11,11-dimethyl-N-(6-nitro-1,3-benzodioxol-5-yl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-11,11-dimethyl-N-(6-nitro-1,3-benzodioxol-5-yl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18834949 |
| Molecular Formula | C21H16N6O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4,5-dicyano-11,11-dimethyl-N-(6-nitro-1,3-benzodioxol-5-yl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)Nc1cc3c(cc1[N+](=O)[O-])OCO3)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C21H16N6O5/c1-20(2)10-3-4-21(20,18-17(10)24-12(7-22)13(8-23)25-18)19(28)26-11-5-15-16(32-9-31-15)6-14(11)27(29)30/h5-6,10H,3-4,9H2,1-2H3,(H,26,28) |
| InChIKey | QDGSWHLCAAAVHT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 164.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|