C20H18N6O — CID 18834835
4,5-dicyano-11,11-dimethyl-N-(pyridin-3-ylmethyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18834835) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is 4,5-dicyano-11,11-dimethyl-N-(pyridin-3-ylmethyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-11,11-dimethyl-N-(pyridin-3-ylmethyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18834835 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4,5-dicyano-11,11-dimethyl-N-(pyridin-3-ylmethyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)NCc1cccnc1)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C20H18N6O/c1-19(2)13-5-6-20(19,18(27)24-11-12-4-3-7-23-10-12)17-16(13)25-14(8-21)15(9-22)26-17/h3-4,7,10,13H,5-6,11H2,1-2H3,(H,24,27) |
| InChIKey | LFARMQMRDAJANW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |