C21H28N2O — CID 7366977
[(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 7366977) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 7366977 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | [(1R,4R)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1(C(=O)N1CCN(c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C21H28N2O/c1-16-20(2,3)17-9-10-21(16,15-17)19(24)23-13-11-22(12-14-23)18-7-5-4-6-8-18/h4-8,17H,1,9-15H2,2-3H3/t17-,21-/m1/s1 |
| InChIKey | FQCZJYGCHWWGKJ-DYESRHJHSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|