C16H18BrNO2 — CID 18834254
N-(2-bromophenyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18834254) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-(2-bromophenyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18834254 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-(2-bromophenyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)Nc1ccccc1Br)C(=O)C2 |
| InChI | InChI=1S/C16H18BrNO2/c1-15(2)10-7-8-16(15,13(19)9-10)14(20)18-12-6-4-3-5-11(12)17/h3-6,10H,7-9H2,1-2H3,(H,18,20) |
| InChIKey | BRZSIWFWUPQWSS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|