C16H19Br2NO — CID 98144407
(1R,4R,6R)-6-bromo-N-(2-bromophenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 98144407) has the molecular formula C16H19Br2NO and a molecular weight of 401.14 g/mol. Its IUPAC name is (1R,4R,6R)-6-bromo-N-(2-bromophenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | (1R,4R,6R)-6-bromo-N-(2-bromophenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98144407 |
| Molecular Formula | C16H19Br2NO |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | (1R,4R,6R)-6-bromo-N-(2-bromophenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(C(=O)Nc1ccccc1Br)[C@@H]2Br |
| InChI | InChI=1S/C16H19Br2NO/c1-14(2)15(3)8-9-16(14,12(15)18)13(20)19-11-7-5-4-6-10(11)17/h4-7,12H,8-9H2,1-3H3,(H,19,20)/t12-,15+,16+/m1/s1 |
| InChIKey | DLRVFCBBSLTBCI-KCXAZCMYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|