C22H24BrNOS — CID 4728183
6-bromo-4,5,5-trimethyl-N-(2-phenylsulfanylphenyl)bicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4728183) has the molecular formula C22H24BrNOS and a molecular weight of 430.41 g/mol. Its IUPAC name is 6-bromo-4,5,5-trimethyl-N-(2-phenylsulfanylphenyl)bicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-4,5,5-trimethyl-N-(2-phenylsulfanylphenyl)bicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4728183 |
| Molecular Formula | C22H24BrNOS |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 6-bromo-4,5,5-trimethyl-N-(2-phenylsulfanylphenyl)bicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccccc3Sc3ccccc3)(C1Br)C2(C)C |
| InChI | InChI=1S/C22H24BrNOS/c1-20(2)21(3)13-14-22(20,18(21)23)19(25)24-16-11-7-8-12-17(16)26-15-9-5-4-6-10-15/h4-12,18H,13-14H2,1-3H3,(H,24,25) |
| InChIKey | JEMSWSDFURJMSZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|