C19H27BrN2O3S — CID 4861452
6-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4861452) has the molecular formula C19H27BrN2O3S and a molecular weight of 443.41 g/mol. Its IUPAC name is 6-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4861452 |
| Molecular Formula | C19H27BrN2O3S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 6-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)C12CCC(C)(C1Br)C2(C)C |
| InChI | InChI=1S/C19H27BrN2O3S/c1-12-7-8-13(26(24,25)22(5)6)11-14(12)21-16(23)19-10-9-18(4,15(19)20)17(19,2)3/h7-8,11,15H,9-10H2,1-6H3,(H,21,23) |
| InChIKey | WPMQPBAKSBEJDS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|