C17H22N2O5S — CID 42924461
6-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 42924461) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 6-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 42924461 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C17H22N2O5S/c1-11-8-9-12(25(23,24)19(2)3)10-15(11)18-16(20)13-6-4-5-7-14(13)17(21)22/h4-5,8-10,13-14H,6-7H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | KYJGWJJBPQMDCH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|