C17H21BrClNO — CID 4728172
6-bromo-N-(3-chloro-4-methylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4728172) has the molecular formula C17H21BrClNO and a molecular weight of 370.72 g/mol. Its IUPAC name is 6-bromo-N-(3-chloro-4-methylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-N-(3-chloro-4-methylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4728172 |
| Molecular Formula | C17H21BrClNO |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 6-bromo-N-(3-chloro-4-methylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C23CCC(C)(C2Br)C3(C)C)cc1Cl |
| InChI | InChI=1S/C17H21BrClNO/c1-10-5-6-11(9-12(10)19)20-14(21)17-8-7-16(4,13(17)18)15(17,2)3/h5-6,9,13H,7-8H2,1-4H3,(H,20,21) |
| InChIKey | KGPIAXWFXDVBDI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|