C20H27BrN2O4S — CID 4728505
2-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4728505) has the molecular formula C20H27BrN2O4S and a molecular weight of 471.42 g/mol. Its IUPAC name is 2-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 2-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4728505 |
| Molecular Formula | C20H27BrN2O4S |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-bromo-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)C12CCC(C)(C(=O)C1Br)C2(C)C |
| InChI | InChI=1S/C20H27BrN2O4S/c1-12-7-8-13(28(26,27)23(5)6)11-14(12)22-17(25)20-10-9-19(4,18(20,2)3)16(24)15(20)21/h7-8,11,15H,9-10H2,1-6H3,(H,22,25) |
| InChIKey | IBLDJZQSHYBJHO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|