C17H18BrF2NO2 — CID 18858633
2-bromo-N-(2,4-difluorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18858633) has the molecular formula C17H18BrF2NO2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2-bromo-N-(2,4-difluorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 2-bromo-N-(2,4-difluorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18858633 |
| Molecular Formula | C17H18BrF2NO2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-bromo-N-(2,4-difluorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccc(F)cc3F)(C(Br)C1=O)C2(C)C |
| InChI | InChI=1S/C17H18BrF2NO2/c1-15(2)16(3)6-7-17(15,12(18)13(16)22)14(23)21-11-5-4-9(19)8-10(11)20/h4-5,8,12H,6-7H2,1-3H3,(H,21,23) |
| InChIKey | ROQJHHRESKGMND-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|