C18H16F2N2O2 — CID 108980715
1-N-(2,4-difluorophenyl)-1-N'-(2-methylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108980715) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is 1-N-(2,4-difluorophenyl)-1-N'-(2-methylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2,4-difluorophenyl)-1-N'-(2-methylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108980715 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-N-(2,4-difluorophenyl)-1-N'-(2-methylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)C1(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H16F2N2O2/c1-11-4-2-3-5-14(11)21-16(23)18(8-9-18)17(24)22-15-7-6-12(19)10-13(15)20/h2-7,10H,8-9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | PIBDCQJLYLGVCR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|