C17H22F2N2O2 — CID 108980321
1-N-(2,4-difluorophenyl)-1-N',1-N'-dipropylcyclopropane-1,1-dicarboxamide (PubChem CID 108980321) has the molecular formula C17H22F2N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-N-(2,4-difluorophenyl)-1-N',1-N'-dipropylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2,4-difluorophenyl)-1-N',1-N'-dipropylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108980321 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-N-(2,4-difluorophenyl)-1-N',1-N'-dipropylcyclopropane-1,1-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H22F2N2O2/c1-3-9-21(10-4-2)16(23)17(7-8-17)15(22)20-14-6-5-12(18)11-13(14)19/h5-6,11H,3-4,7-10H2,1-2H3,(H,20,22) |
| InChIKey | GPLZFJGYBICYID-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|