C19H21F2N3O2 — CID 109107640
3-N-(2,4-difluorophenyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide (PubChem CID 109107640) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 3-N-(2,4-difluorophenyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(2,4-difluorophenyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107640 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-N-(2,4-difluorophenyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cncc(C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-3-7-24(8-4-2)19(26)14-9-13(11-22-12-14)18(25)23-17-6-5-15(20)10-16(17)21/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,23,25) |
| InChIKey | OYBDPFJLGACBGI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |