C17H19BrINO2 — CID 6588475
(1R,2S,4R)-2-bromo-N-(4-iodophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 6588475) has the molecular formula C17H19BrINO2 and a molecular weight of 476.15 g/mol. Its IUPAC name is (1R,2S,4R)-2-bromo-N-(4-iodophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,2S,4R)-2-bromo-N-(4-iodophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 6588475 |
| Molecular Formula | C17H19BrINO2 |
| Molecular Weight | 476.15 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | (1R,2S,4R)-2-bromo-N-(4-iodophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(C(=O)Nc1ccc(I)cc1)[C@H](Br)C2=O |
| InChI | InChI=1S/C17H19BrINO2/c1-15(2)16(3)8-9-17(15,12(18)13(16)21)14(22)20-11-6-4-10(19)5-7-11/h4-7,12H,8-9H2,1-3H3,(H,20,22)/t12-,16+,17+/m1/s1 |
| InChIKey | ZTALIWZCTIZYQA-DQYPLSBCSA-N |
| XLogP | 4.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|