C17H18BrCl2NO2 — CID 40955843
(1R,2S,4S)-2-bromo-N-(2,3-dichlorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 40955843) has the molecular formula C17H18BrCl2NO2 and a molecular weight of 419.15 g/mol. Its IUPAC name is (1R,2S,4S)-2-bromo-N-(2,3-dichlorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,2S,4S)-2-bromo-N-(2,3-dichlorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 40955843 |
| Molecular Formula | C17H18BrCl2NO2 |
| Molecular Weight | 419.15 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | (1R,2S,4S)-2-bromo-N-(2,3-dichlorophenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@]2(C)CC[C@@]1(C(=O)Nc1cccc(Cl)c1Cl)[C@H](Br)C2=O |
| InChI | InChI=1S/C17H18BrCl2NO2/c1-15(2)16(3)7-8-17(15,12(18)13(16)22)14(23)21-10-6-4-5-9(19)11(10)20/h4-6,12H,7-8H2,1-3H3,(H,21,23)/t12-,16-,17+/m1/s1 |
| InChIKey | VOVBTBDAIMOLGY-JLZZUVOBSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|