C16H19BrN2O2 — CID 98152147
(1R,2S,4R)-2-bromo-4,7,7-trimethyl-3-oxo-N-pyridin-3-ylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98152147) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is (1R,2S,4R)-2-bromo-4,7,7-trimethyl-3-oxo-N-pyridin-3-ylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,2S,4R)-2-bromo-4,7,7-trimethyl-3-oxo-N-pyridin-3-ylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98152147 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1R,2S,4R)-2-bromo-4,7,7-trimethyl-3-oxo-N-pyridin-3-ylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(C(=O)Nc1cccnc1)[C@H](Br)C2=O |
| InChI | InChI=1S/C16H19BrN2O2/c1-14(2)15(3)6-7-16(14,11(17)12(15)20)13(21)19-10-5-4-8-18-9-10/h4-5,8-9,11H,6-7H2,1-3H3,(H,19,21)/t11-,15+,16+/m1/s1 |
| InChIKey | DDVDWFCVOIQBSE-RLCCDNCMSA-N |
| XLogP | 3.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|