C16H24BrNO2 — CID 3399336
3-bromo-1,7,7-trimethyl-4-(piperidine-1-carbonyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 3399336) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-bromo-1,7,7-trimethyl-4-(piperidine-1-carbonyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-bromo-1,7,7-trimethyl-4-(piperidine-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 3399336 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-bromo-1,7,7-trimethyl-4-(piperidine-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=O)N3CCCCC3)(C(Br)C1=O)C2(C)C |
| InChI | InChI=1S/C16H24BrNO2/c1-14(2)15(3)7-8-16(14,11(17)12(15)19)13(20)18-9-5-4-6-10-18/h11H,4-10H2,1-3H3 |
| InChIKey | SPFWMAKXCTWFLU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|