C15H23BrN2O2 — CID 98908328
(1S,3R,4S)-3-bromo-1,7,7-trimethyl-4-(piperazine-1-carbonyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 98908328) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is (1S,3R,4S)-3-bromo-1,7,7-trimethyl-4-(piperazine-1-carbonyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4S)-3-bromo-1,7,7-trimethyl-4-(piperazine-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98908328 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (1S,3R,4S)-3-bromo-1,7,7-trimethyl-4-(piperazine-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@]2(C(=O)N3CCNCC3)CC[C@]1(C)C(=O)[C@@H]2Br |
| InChI | InChI=1S/C15H23BrN2O2/c1-13(2)14(3)4-5-15(13,10(16)11(14)19)12(20)18-8-6-17-7-9-18/h10,17H,4-9H2,1-3H3/t10-,14+,15+/m0/s1 |
| InChIKey | MMPGHLULZXDWJQ-COLVAYQJSA-N |
| XLogP | 1.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|