About (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone
(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone (PubChem CID 102547272) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone |
| PubChem CID | 102547272 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone |
| SMILES | CC1(C)C2CCC1(C(=O)N1CCNCC1)C(O)C2 |
| InChI | InChI=1S/C14H24N2O2/c1-13(2)10-3-4-14(13,11(17)9-10)12(18)16-7-5-15-6-8-16/h10-11,15,17H,3-9H2,1-2H3 |
| InChIKey | UHJMLYDSMGHPOM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone?
The IUPAC name of (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone (CID 102547272) is (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone.
What is the SMILES notation for (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone?
The canonical SMILES for (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone is CC1(C)C2CCC1(C(=O)N1CCNCC1)C(O)C2.
What is the InChIKey of (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone?
The InChIKey is UHJMLYDSMGHPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-13(2)10-3-4-14(13,11(17)9-10)12(18)16-7-5-15-6-8-16/h10-11,15,17H,3-9H2,1-2H3.
What are the key properties of (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone?
(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone has a molecular weight of 252.36 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)-piperazin-1-ylmethanone is sourced from PubChem (CID 102547272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).