C15H24BrNO2 — CID 98151575
(1S,2R,4S)-2-bromo-N-butyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98151575) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is (1S,2R,4S)-2-bromo-N-butyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,2R,4S)-2-bromo-N-butyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98151575 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (1S,2R,4S)-2-bromo-N-butyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CCCCNC(=O)[C@@]12CC[C@](C)(C(=O)[C@@H]1Br)C2(C)C |
| InChI | InChI=1S/C15H24BrNO2/c1-5-6-9-17-12(19)15-8-7-14(4,13(15,2)3)11(18)10(15)16/h10H,5-9H2,1-4H3,(H,17,19)/t10-,14+,15+/m0/s1 |
| InChIKey | LFKFOZVBTANXNZ-COLVAYQJSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|