C15H24BrNO3 — CID 98152140
(1S,2S,4S)-2-bromo-N-(3-methoxypropyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98152140) has the molecular formula C15H24BrNO3 and a molecular weight of 346.27 g/mol. Its IUPAC name is (1S,2S,4S)-2-bromo-N-(3-methoxypropyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,2S,4S)-2-bromo-N-(3-methoxypropyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98152140 |
| Molecular Formula | C15H24BrNO3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (1S,2S,4S)-2-bromo-N-(3-methoxypropyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | COCCCNC(=O)[C@@]12CC[C@](C)(C(=O)[C@H]1Br)C2(C)C |
| InChI | InChI=1S/C15H24BrNO3/c1-13(2)14(3)6-7-15(13,10(16)11(14)18)12(19)17-8-5-9-20-4/h10H,5-9H2,1-4H3,(H,17,19)/t10-,14-,15-/m1/s1 |
| InChIKey | MZPJXEDZMIUQEJ-VCTAVGKDSA-N |
| XLogP | 2.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|