C13H20Br3NO2 — CID 4861379
6-bromo-4-(dibromomethyl)-N-(2-methoxyethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4861379) has the molecular formula C13H20Br3NO2 and a molecular weight of 462.02 g/mol. Its IUPAC name is 6-bromo-4-(dibromomethyl)-N-(2-methoxyethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-4-(dibromomethyl)-N-(2-methoxyethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4861379 |
| Molecular Formula | C13H20Br3NO2 |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 458.90 |
| IUPAC Name | 6-bromo-4-(dibromomethyl)-N-(2-methoxyethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | COCCNC(=O)C12CCC(C(Br)Br)(C1Br)C2(C)C |
| InChI | InChI=1S/C13H20Br3NO2/c1-11(2)12(9(15)16)4-5-13(11,8(12)14)10(18)17-6-7-19-3/h8-9H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | GFXWKVVQOLMEEB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|