C12H18Br3NO — CID 98142940
(1R,4S,6S)-6-bromo-4-(dibromomethyl)-N,N,5,5-tetramethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 98142940) has the molecular formula C12H18Br3NO and a molecular weight of 431.99 g/mol. Its IUPAC name is (1R,4S,6S)-6-bromo-4-(dibromomethyl)-N,N,5,5-tetramethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | (1R,4S,6S)-6-bromo-4-(dibromomethyl)-N,N,5,5-tetramethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98142940 |
| Molecular Formula | C12H18Br3NO |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 428.89 |
| IUPAC Name | (1R,4S,6S)-6-bromo-4-(dibromomethyl)-N,N,5,5-tetramethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CN(C)C(=O)[C@]12CC[C@@](C(Br)Br)([C@H]1Br)C2(C)C |
| InChI | InChI=1S/C12H18Br3NO/c1-10(2)11(8(14)15)5-6-12(10,7(11)13)9(17)16(3)4/h7-8H,5-6H2,1-4H3/t7-,11+,12+/m1/s1 |
| InChIKey | TVONSFUYJGNUKO-MKCWBWRRSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|