C15H17Br3N2O — CID 3525410
6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-pyridin-4-ylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 3525410) has the molecular formula C15H17Br3N2O and a molecular weight of 481.03 g/mol. Its IUPAC name is 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-pyridin-4-ylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-pyridin-4-ylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 3525410 |
| Molecular Formula | C15H17Br3N2O |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 477.89 |
| IUPAC Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-pyridin-4-ylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)C2(C(=O)Nc3ccncc3)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C15H17Br3N2O/c1-13(2)14(11(17)18)5-6-15(13,10(14)16)12(21)20-9-3-7-19-8-4-9/h3-4,7-8,10-11H,5-6H2,1-2H3,(H,19,20,21) |
| InChIKey | XDVXLFQAMFXYPI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|