C16H17Br3ClNO — CID 98144367
(1R,4S,6S)-6-bromo-N-(3-chlorophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 98144367) has the molecular formula C16H17Br3ClNO and a molecular weight of 514.48 g/mol. Its IUPAC name is (1R,4S,6S)-6-bromo-N-(3-chlorophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | (1R,4S,6S)-6-bromo-N-(3-chlorophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98144367 |
| Molecular Formula | C16H17Br3ClNO |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 510.85 |
| IUPAC Name | (1R,4S,6S)-6-bromo-N-(3-chlorophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C(=O)Nc3cccc(Cl)c3)CC[C@@]1(C(Br)Br)[C@H]2Br |
| InChI | InChI=1S/C16H17Br3ClNO/c1-14(2)15(12(18)19)6-7-16(14,11(15)17)13(22)21-10-5-3-4-9(20)8-10/h3-5,8,11-12H,6-7H2,1-2H3,(H,21,22)/t11-,15+,16+/m1/s1 |
| InChIKey | VSGWWOPDSKISBH-RLCCDNCMSA-N |
| XLogP | 5.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|