C18H21Br3N2O2 — CID 4728127
6-bromo-4-(dibromomethyl)-5,5-dimethyl-N'-(3-methylbenzoyl)bicyclo[2.1.1]hexane-1-carbohydrazide (PubChem CID 4728127) has the molecular formula C18H21Br3N2O2 and a molecular weight of 537.09 g/mol. Its IUPAC name is 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N'-(3-methylbenzoyl)bicyclo[2.1.1]hexane-1-carbohydrazide.
| Compound Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N'-(3-methylbenzoyl)bicyclo[2.1.1]hexane-1-carbohydrazide |
|---|---|
| PubChem CID | 4728127 |
| Molecular Formula | C18H21Br3N2O2 |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 533.92 |
| IUPAC Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N'-(3-methylbenzoyl)bicyclo[2.1.1]hexane-1-carbohydrazide |
| SMILES | Cc1cccc(C(=O)NNC(=O)C23CCC(C(Br)Br)(C2Br)C3(C)C)c1 |
| InChI | InChI=1S/C18H21Br3N2O2/c1-10-5-4-6-11(9-10)12(24)22-23-15(25)18-8-7-17(13(18)19,14(20)21)16(18,2)3/h4-6,9,13-14H,7-8H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | USELZOWIAJAQLH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|