C17H19Br3N2O2 — CID 4728125
N'-benzoyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide (PubChem CID 4728125) has the molecular formula C17H19Br3N2O2 and a molecular weight of 523.06 g/mol. Its IUPAC name is N'-benzoyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide.
| Compound Name | N'-benzoyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
|---|---|
| PubChem CID | 4728125 |
| Molecular Formula | C17H19Br3N2O2 |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 519.90 |
| IUPAC Name | N'-benzoyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
| SMILES | CC1(C)C2(C(=O)NNC(=O)c3ccccc3)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C17H19Br3N2O2/c1-15(2)16(13(19)20)8-9-17(15,12(16)18)14(24)22-21-11(23)10-6-4-3-5-7-10/h3-7,12-13H,8-9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | NVDBMKKBXREFQS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|