C10H14Br3NO — CID 98043685
(1S,4R,6S)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 98043685) has the molecular formula C10H14Br3NO and a molecular weight of 403.94 g/mol. Its IUPAC name is (1S,4R,6S)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | (1S,4R,6S)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98043685 |
| Molecular Formula | C10H14Br3NO |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 400.86 |
| IUPAC Name | (1S,4R,6S)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)[C@]2(C(N)=O)CC[C@]1(C(Br)Br)[C@H]2Br |
| InChI | InChI=1S/C10H14Br3NO/c1-8(2)9(6(12)13)3-4-10(8,5(9)11)7(14)15/h5-6H,3-4H2,1-2H3,(H2,14,15)/t5-,9-,10-/m1/s1 |
| InChIKey | WRGBBEYNVBRDQZ-UAINPKIQSA-N |
| XLogP | 3.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|