C20H28Br3NO2 — CID 4861380
[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylate (PubChem CID 4861380) has the molecular formula C20H28Br3NO2 and a molecular weight of 554.16 g/mol. Its IUPAC name is [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylate.
| Compound Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylate |
|---|---|
| PubChem CID | 4861380 |
| Molecular Formula | C20H28Br3NO2 |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylate |
| SMILES | CC12CCC(CC1=NOC(=O)C13CCC(C(Br)Br)(C1Br)C3(C)C)C2(C)C |
| InChI | InChI=1S/C20H28Br3NO2/c1-16(2)11-6-7-18(16,5)12(10-11)24-26-15(25)20-9-8-19(13(20)21,14(22)23)17(20,3)4/h11,13-14H,6-10H2,1-5H3 |
| InChIKey | CWODUSGLWSUECA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|