C20H30BrNO2 — CID 4861455
[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxylate (PubChem CID 4861455) has the molecular formula C20H30BrNO2 and a molecular weight of 396.37 g/mol. Its IUPAC name is [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxylate.
| Compound Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxylate |
|---|---|
| PubChem CID | 4861455 |
| Molecular Formula | C20H30BrNO2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 6-bromo-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxylate |
| SMILES | CC12CCC(CC1=NOC(=O)C13CCC(C)(C1Br)C3(C)C)C2(C)C |
| InChI | InChI=1S/C20H30BrNO2/c1-16(2)12-7-8-18(16,5)13(11-12)22-24-15(23)20-10-9-19(6,14(20)21)17(20,3)4/h12,14H,7-11H2,1-6H3 |
| InChIKey | QCIXLDTYIHCDFM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|