C17H20Br3NO — CID 4513020
6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-(2-methylphenyl)bicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4513020) has the molecular formula C17H20Br3NO and a molecular weight of 494.07 g/mol. Its IUPAC name is 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-(2-methylphenyl)bicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-(2-methylphenyl)bicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4513020 |
| Molecular Formula | C17H20Br3NO |
| Molecular Weight | 494.07 g/mol |
| Exact Mass | 490.91 |
| IUPAC Name | 6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-(2-methylphenyl)bicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C12CCC(C(Br)Br)(C1Br)C2(C)C |
| InChI | InChI=1S/C17H20Br3NO/c1-10-6-4-5-7-11(10)21-14(22)17-9-8-16(12(17)18,13(19)20)15(17,2)3/h4-7,12-13H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | MGZZSDJEQNKCHX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.07 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|