C18H24BrNO — CID 4728185
6-bromo-N-(2,3-dimethylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4728185) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dimethylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-N-(2,3-dimethylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4728185 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 6-bromo-N-(2,3-dimethylphenyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)C23CCC(C)(C2Br)C3(C)C)c1C |
| InChI | InChI=1S/C18H24BrNO/c1-11-7-6-8-13(12(11)2)20-15(21)18-10-9-17(5,14(18)19)16(18,3)4/h6-8,14H,9-10H2,1-5H3,(H,20,21) |
| InChIKey | DWHHWATXGDSZJK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|