C18H21BrClNO2 — CID 4654283
2-bromo-N-(3-chloro-2-methylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4654283) has the molecular formula C18H21BrClNO2 and a molecular weight of 398.73 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-2-methylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 2-bromo-N-(3-chloro-2-methylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4654283 |
| Molecular Formula | C18H21BrClNO2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-bromo-N-(3-chloro-2-methylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C12CCC(C)(C(=O)C1Br)C2(C)C |
| InChI | InChI=1S/C18H21BrClNO2/c1-10-11(20)6-5-7-12(10)21-15(23)18-9-8-17(4,16(18,2)3)14(22)13(18)19/h5-7,13H,8-9H2,1-4H3,(H,21,23) |
| InChIKey | AVERYTZIQJHZAZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|