C21H28BrNO2 — CID 4728417
2-bromo-N-(4-butylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4728417) has the molecular formula C21H28BrNO2 and a molecular weight of 406.36 g/mol. Its IUPAC name is 2-bromo-N-(4-butylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 2-bromo-N-(4-butylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4728417 |
| Molecular Formula | C21H28BrNO2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-bromo-N-(4-butylphenyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C23CCC(C)(C(=O)C2Br)C3(C)C)cc1 |
| InChI | InChI=1S/C21H28BrNO2/c1-5-6-7-14-8-10-15(11-9-14)23-18(25)21-13-12-20(4,19(21,2)3)17(24)16(21)22/h8-11,16H,5-7,12-13H2,1-4H3,(H,23,25) |
| InChIKey | MXXZCXPKKLIBHI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|