C21H28BrNO4 — CID 98351048
(1S,2R,4S)-2-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98351048) has the molecular formula C21H28BrNO4 and a molecular weight of 438.36 g/mol. Its IUPAC name is (1S,2R,4S)-2-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,2R,4S)-2-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98351048 |
| Molecular Formula | C21H28BrNO4 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (1S,2R,4S)-2-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@@]23CC[C@](C)(C(=O)[C@@H]2Br)C3(C)C)cc1OC |
| InChI | InChI=1S/C21H28BrNO4/c1-19(2)20(3)9-10-21(19,16(22)17(20)24)18(25)23-11-8-13-6-7-14(26-4)15(12-13)27-5/h6-7,12,16H,8-11H2,1-5H3,(H,23,25)/t16-,20+,21+/m0/s1 |
| InChIKey | QKVJGTNRBPVIQY-ZLGUVYLKSA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|