C15H20N2O3S — CID 80593163
1-carbamothioyl-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 80593163) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-carbamothioyl-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80593163 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-carbamothioyl-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(C(N)=S)CC2)cc1OC |
| InChI | InChI=1S/C15H20N2O3S/c1-19-11-4-3-10(9-12(11)20-2)5-8-17-14(18)15(6-7-15)13(16)21/h3-4,9H,5-8H2,1-2H3,(H2,16,21)(H,17,18) |
| InChIKey | BRVLFNQVKFGUGX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|